Gallagic acid
Gallagic acid
 |
Identifiers |
|
65995-62-2 |
3D model (Jmol) |
Interactive image |
Oc4c6c1c(c5c(=O)o6)c(oc(=O)c1c(c4O)-c(c(O)c2O)c(C(O)=O)cc2O)c(O)c(O)c5-c3c(C(O)=O)cc(O)c(O)c3O
|
Properties |
|
C28H14O18 |
Molar mass |
638.39 g/mol |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa). |
Y verify (what is Y N ?) |
Infobox references |
|
|
Gallagic acid is a polyphenolic chemical compound that can be found in the ellagitannins, a type of tannin, found in Punica granatum (pomegranate).[1] It is a building block of the corresponding tannin punicalagin, punicalin, punicacortein C and 2-O-galloyl-punicalin.
See also
- Gallagic acid dilactone (a.k.a. gallagyldilactone or terminalin)
References
- ↑ Antioxidant, antimalarial and antimicrobial activities of tannin-rich fractions, ellagitannins and phenolic acids from Punica granatum L. Reddy Muntha K., Gupta Sashi K., Jacob Melissa R., Khan Shabana I. and Ferreira Daneel, Planta medica, 2007, vol. 73, no5, pp. 461-467, INIST:18773247
|
---|
|
Moieties | |
---|
|
Lactones | |
---|
|
Monomers |
- Acetonyl geraniin
- Alnusiin
- Bicornin
- Carlesiin
- Casuarictin
- Emblicanin A and B
- Euscaphinin
- Galloyl pedunculagin
- Grandinin
- Helioscopinin B
- Jolkinin
- Lagerstannin A, B and C
- Macranganin
- Myrobalanitannin
- Nupharin A, B, C, D, E and F
- Pedunculagin
- Punicalagin
- Punigluconin
- Phyllanemblinin A, B, C, D, E and F
- Punicalin
- Roburin E
- Rugosin E
- Sanguiin H-5
- Stenophyllanin A, B and C
- Strictinin
- Tellimagrandin I and II
- Teracatain
- Terchebulin
- Terflavin A and B
- Tergallic acid
- Tergallic acid dilactone
C-glycosidic ellagitannins | |
---|
| | |
---|
| Transformed ellagitannins | | |
---|
| molecules with Elaeocarpusinic acid |
- Elaeocarpusin
- Helioscopin B
- Mallojaponin (1-O-Galloyl-2,4-elaeocarpusinoyl-3,6-(R)-valoneayl-beta-D-glucose)
|
---|
|
---|
|
---|
|
Oligomers | |
---|
|
Other | |
---|