Alanine (data page)

The complete data for Alanine
	General information Chemical formula: C3H7NO2 Molar mass: 89.1 g·mol^−1 Systematic name: (S)-2-aminopropanoic acid Abbreviations: A, Ala Synonyms: 2-aminopropanoic acid {α/2}-aminopropionic acid AIDS{-}071780 HSDB 1801 NSC 206315
Database data
SMILES: N[C@@]([H])(C)C(O)=O InChI=1/C3H7NO2/c1-2(4)3(5)6/h2H,4H2,1H3,(H,5,6)/f/h5H ATC: N/A CAS: 338-69-2 (D), 56-41-7 (L) DrugBank: N/A EINECS: 206-418-1 (D)^a, 200-273-8 (L)^a PubChem: 602 (D)^a, 5950 (L)^a
Physical properties
Structure Crystal data Spectral data UV-Vis IR NMR MS - Masses of main fragments: Alanine GC-MS spectrum Phase behavior Solid properties ρsolid: 1.401 g.cm^−3 Tm: 297 °C Liquid properties Gas properties
Hazard properties
MSDS N/A Main hazards: - N/A NFPA 704 Flash point - N/A R/S statement R: N/A S: N/A RTECS number: N/A
Chemical properties
XLogP: -2.912 pI: 6.00 pKa: 2.33, 9.71 Tautomers: Hydrogen bond: donor - 2;  acceptor - 3
Pharmacological properties
Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa)

References

1. ^a 206-418-1 EINECS for D-alanine
2. ^a 200-273-8 EINECS for L-alanine
3. ^a CID 602 from PubChem
4. ^a CID 5950 from PubChem